| Name | Dipropyl Succinate |
| Synonyms | Dipropyl Succinate DIPROPYL SUCCINATE TIMTEC-BB SBB008393 Dipropylbutanedioate dipropyl butanedioate Di-n-propyl succinate DI-N-PROPYL SUCCINATE Succinicaciddi-n-propylester butanedioic acid dipropyl ester Butanedioic acid, dipropyl ester Dipropylester kyseliny jantarove Di-n-propyl succinate, (Succinic acid di-n-propyl ester) |
| CAS | 925-15-5 |
| EINECS | 213-114-2 |
| InChI | InChI=1/C10H18O4/c1-3-7-13-9(11)5-6-10(12)14-8-4-2/h3-8H2,1-2H3 |
| Molecular Formula | C10H18O4 |
| Molar Mass | 202.25 |
| Density | 1 g/cm3 |
| Melting Point | -5.9°C |
| Boling Point | 250-252°C |
| Flash Point | 250-252°C |
| Vapor Presure | 0.0212mmHg at 25°C |
| Storage Condition | 2-8°C |
| Refractive Index | 1.4250 (estimate) |
| MDL | MFCD00015213 |
| Use | Used as solvent, plastic, perfume intermediate, gas chromatography stationary liquid |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | 52/53 - Harmful to aquatic organisms, may cause long-term adverse effects in the aquatic environment. |
| RTECS | WM7750000 |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| Use | as an intermediate for solvents, plastics, fragrances, gas chromatography stationary liquid |